For research use only. Not for therapeutic Use.
L-Monapterin is a naturally occurring pteridine derivative used extensively in biochemical and pharmaceutical research. Known for its role in the biosynthesis of tetrahydrobiopterin, it is essential for studying enzymatic functions and metabolic pathways related to neurotransmitter synthesis. This compound’s high purity ensures reliable and consistent results in experimental procedures. Its applications extend to understanding genetic disorders, developing therapeutic agents, and exploring enzyme deficiencies, making L-Monapterin a valuable tool in advanced medical research and drug development.
Catalog Number | R027416 |
CAS Number | 2277-42-1 |
Synonyms | L-threo-1-(2-Amino-4-hydroxy-6-pteridinyl)-1,2,3-propanetriol; [S-(R*,R*)]-2-amino-6-(1,2,3-trihydroxypropyl)-4(1H)pteridinone;?2-Amino-6-[(1S,2S)-1,2,3-trihydroxypropyl]-4(1H)-pteridinone;?2-Aino-6-(L-threo-trihydroxypropyl)-4(3H)-Pteridinone; L-(+) |
Molecular Formula | C9H11N5O4 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | 2-amino-6-[(1S,2S)-1,2,3-trihydroxypropyl]-1H-pteridin-4-one |
InChI | InChI=1S/C9H11N5O4/c10-9-13-7-5(8(18)14-9)12-3(1-11-7)6(17)4(16)2-15/h1,4,6,15-17H,2H2,(H3,10,11,13,14,18)/t4-,6-/m0/s1 |
InChIKey | BMQYVXCPAOLZOK-NJGYIYPDSA-N |
SMILES | C1=C(N=C2C(=N1)NC(=NC2=O)N)C(C(CO)O)O |