L-Ornithine (Cat.No:I004638) is a non-proteinogenic amino acid that plays a vital role in the urea cycle, a metabolic pathway involved in the detoxification of ammonia. It is also a precursor for the synthesis of polyamines, which are essential for cell growth and regeneration. L-Ornithine is often used as a dietary supplement to support athletic performance, liver health, and wound healing.
| Catalog Number | I004638 |
| CAS Number | 70-26-8 |
| Molecular Formula | C5H12N2O2 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | 3 years -20℃ powder |
| IUPAC Name | (2S)-2,5-diaminopentanoic acid |
| InChI | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | AHLPHDHHMVZTML-BYPYZUCNSA-N |
| SMILES | C(CC(C(=O)O)N)CN |
| Reference | <p style=/line-height:25px/> |
