L-Phenylalanine-13C6 is a stable isotope-labeled form of L-phenylalanine, where all six carbon atoms are replaced with carbon-13. This isotopic labeling is used primarily in metabolic studies and tracer experiments to track the metabolic pathways of phenylalanine. L-phenylalanine is an essential amino acid involved in protein synthesis and the production of neurotransmitters like dopamine. The carbon-13 labeling allows for precise monitoring and quantification of phenylalanine metabolism and its derivatives using mass spectrometry and NMR spectroscopy, facilitating research in nutrition, metabolic disorders, and drug development.
Catalog Number | R057523 |
CAS Number | 180268-82-0 |
Synonyms | (2S)-2-Amino-3-phenylpropanoic Acid-13C6; (S)-(-)-Phenylalanine-13C6; (S)-α-Amino-β-phenylpropionic Acid-13C6; (S)-α-Aminohydrocinnamic Acid-13C6; (S)-α-Amino-benzenepropanoic Acid-13C6; |
Molecular Formula | C9H11NO2 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid |
InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i1+1,2+1,3+1,4+1,5+1,7+1 |
InChIKey | COLNVLDHVKWLRT-KILZIXFTSA-N |
SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)C[C@@H](C(=O)O)N |