L-Phenylalanine-13C9,15N(Cat No.:S000691) is a fully labeled form of L-phenylalanine, where all nine carbon atoms are enriched with carbon-13 and the nitrogen atom is enriched with nitrogen-15. This extensive isotopic labeling dramatically enhances its traceability in analytical methods like NMR spectroscopy and mass spectrometry, facilitating in-depth studies of protein synthesis and metabolic pathways. L-phenylalanine is an essential amino acid involved in the biosynthesis of proteins. The complete labeling provides precise insights into how phenylalanine is incorporated into proteins and its metabolic roles, particularly in phenylketonuria (PKU) research and other metabolic disorders.
Catalog Number | S000691 |
CAS Number | 878339-23-2 |
Molecular Formula | 13C9H1115NO2 |
Purity | 95% |
IUPAC Name | (2S)-2-(15N)azanyl-3-((1,2,3,4,5,6-13C6)cyclohexatrienyl)(1,2,3-13C3)propanoic acid |
InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1 |
InChIKey | COLNVLDHVKWLRT-CMLFETTRSA-N |
SMILES | C1=CC=C(C=C1)CC(C(=O)O)N |