L-Phenylalanine-3-13C（Cat No.:S000637）is a stable isotope-labeled form of the essential amino acid phenylalanine, where the third carbon atom is enriched with carbon-13 (13C). This specific labeling is crucial for tracing the metabolic pathways of phenylalanine using techniques like mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. L-Phenylalanine-3-13C helps researchers explore how this amino acid is metabolized into other compounds, such as tyrosine, and its role in the biosynthesis of proteins and neurotransmitters. Such studies are vital for understanding metabolic disorders like phenylketonuria and for developing nutritional and therapeutic strategies.
| Catalog Number | S000637 |
| CAS Number | 136056-02-5 |
| Molecular Formula | C813CH11NO2 |
| Purity | 95% |
| IUPAC Name | (2S)-2-amino-3-phenyl(313C)propanoic acid |
| InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i6+1 |
| InChIKey | COLNVLDHVKWLRT-JCNVXSMLSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)N |
