For research use only. Not for therapeutic Use.
L-Phenylalanine-d8(Cat No.:S000577) is a specialized form of phenylalanine, an essential amino acid crucial for protein synthesis and neurotransmitter production. The “d8” designation indicates that eight hydrogen atoms in the phenylalanine molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic substitution enables precise tracking of phenylalanine metabolism and its incorporation into proteins and neurotransmitters using techniques like mass spectrometry. L-Phenylalanine-d8 serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating disorders related to phenylalanine metabolism, such as phenylketonuria and neurological disorders.
CAS Number | 17942-32-4 |
Molecular Formula | C9H3D8NO2 |
Purity | ≥95% |
Target | Neuronal Signaling |
IUPAC Name | (2S)-2-amino-2,3,3-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i1D,2D,3D,4D,5D,6D2,8D |
InChIKey | COLNVLDHVKWLRT-WYMAAGAPSA-N |
SMILES | C1=CC=C(C=C1)CC(C(=O)O)N |