For research use only. Not for therapeutic Use.
L-Phenylmercapturic acid-d5is the deuterium labeledL-Phenylmercapturic acid(HY-143368)[1]. L-Phenylmercapturic acid is often used as a biomarker for exposure to aniline compounds such as aniline and xylene[2].
Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1].
| Catalog Number | R001793 |
| CAS Number | 1331906-27-4 |
| Synonyms | (2S)-2-acetamido-3-(2,3,4,5,6-pentadeuteriophenyl)sulfanylpropanoic acid |
| Molecular Formula | C11H8D5NO3S |
| Purity | ≥95% |
| InChI | InChI=1S/C11H13NO3S/c1-8(13)12-10(11(14)15)7-16-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t10-/m1/s1/i2D,3D,4D,5D,6D |
| InChIKey | CICOZWHZVMOPJS-WYDCHYGLSA-N |
| SMILES | CC(=O)NC(CSC1=CC=CC=C1)C(=O)O |
| Reference | [1]. Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019 Feb;53(2):211-216. [2]. Yardley-Jones A, et al’. The toxicity of benzene and its metabolism and molecular pathology in human risk assessment. Br J Ind Med. 1991 Jul;48(7):437-44. |
