For research use only. Not for therapeutic Use.
L-Proline-13C5（Cat No.:S000580） is a specialized form of proline, a non-essential amino acid crucial for protein structure and various cellular functions. The “13C5” notation indicates that five carbon atoms in the proline molecule are replaced with the stable carbon isotope carbon-13. This isotopic labeling facilitates precise tracking of proline metabolism and its incorporation into proteins and other biomolecules using advanced analytical techniques like mass spectrometry and nuclear magnetic resonance spectroscopy. L-Proline-13C5 serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating diseases related to proline metabolism, such as collagen disorders.
| Catalog Number | S000580 |
| CAS Number | 201740-83-2 |
| Molecular Formula | 13C5H9NO2 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| IUPAC Name | (2S)-(2,3,4,5-13C4)azolidine-2-carboxylic acid |
| InChI | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1/i1+1,2+1,3+1,4+1,5+1 |
| InChIKey | ONIBWKKTOPOVIA-JRGPAWSWSA-N |
| SMILES | C1CC(NC1)C(=O)O |
