L-Proline-13C5,15N（Cat No.:S000738） is a labeled form of L-proline where the molecule has been enriched with carbon-13 at five carbon positions and nitrogen-15 at the nitrogen atom, enhancing its detectability in analytical studies. This isotopic labeling makes it exceptionally useful for sensitive detection methods such as mass spectrometry and NMR spectroscopy. L-Proline is a non-essential amino acid important in protein synthesis and collagen production. Using L-Proline-13C5,15N allows for precise tracking and detailed studies of its incorporation into proteins and its metabolic pathways in biological systems.
| Catalog Number | S000738 |
| CAS Number | 202407-23-6 |
| Molecular Formula | 13C5H915NO2 |
| Purity | 95% |
| IUPAC Name | (2S)-(2,3,4,5-13C4,115N)azolidine-2-carboxylic acid |
| InChI | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | ONIBWKKTOPOVIA-XAFSXMPTSA-N |
| SMILES | C1CC(NC1)C(=O)O |
