For research use only. Not for therapeutic Use.
L-Proline-15N(Cat No.:S000692) is a labeled form of L-proline, where the nitrogen atom is enriched with nitrogen-15, enhancing its detectability in sensitive analytical techniques such as NMR spectroscopy and mass spectrometry. This isotopic labeling is particularly useful for studying proline’s role in protein synthesis and its behavior in peptide bonds. L-Proline is a non-essential amino acid known for its unique cyclic structure, which plays a crucial role in the stability of collagen and the function of enzymes. The 15N label allows for precise tracking and detailed study of proline’s metabolic pathways and interactions in biological systems.
CAS Number | 59681-31-1 |
Molecular Formula | C5H915NO2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-(115N)azolidine-2-carboxylic acid |
InChI | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1/i6+1 |
InChIKey | ONIBWKKTOPOVIA-JGTYJTGKSA-N |
SMILES | C1CC(NC1)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |