For research use only. Not for therapeutic Use.
<p>
L-Proline benzyl ester hydrochloride (CAS 16652-71-4) is <span style="color:#000000;"><span style="font-size:12px;"><span style="font-family: Arial, Helvetica, sans-serif; font-variant-ligatures: normal; orphans: 2; widows: 2;">used as a chiral auxiliary in the asymmetric Diels-Alder reaction.</span></span></span></p>
| Catalog Number | M076637 |
| CAS Number | 16652-71-4 |
| Synonyms | H-Pro-OBzl.HCl; (S)-benzyl pyrrolidine-2-carboxylate hydrochloride |
| Molecular Formula | C12H16ClNO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | benzyl (2S)-pyrrolidine-2-carboxylate;hydrochloride |
| InChI | InChI=1S/C12H15NO2.ClH/c14-12(11-7-4-8-13-11)15-9-10-5-2-1-3-6-10;/h1-3,5-6,11,13H,4,7-9H2;1H/t11-;/m0./s1 |
| InChIKey | NEDMOHHWRPHBAL-MERQFXBCSA-N |
| SMILES | C1CC(NC1)C(=O)OCC2=CC=CC=C2.Cl |
| Reference | <span style="color:#000000;"><span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;">1.<span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">Jemal, Mohammed, and Allen I. Cohen. "Enantiomeric purity determination of l-proline benzyl ester by chiral column gas chromatography." </span><i style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Journal of Chromatography A</i><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;"> 392 (1987): 442-446.</span></span></span></span> |
