For research use only. Not for therapeutic Use.
L-Proline-d7（Cat No.:I044702）is a fully deuterated form of the naturally occurring amino acid L-proline, in which seven hydrogen atoms are replaced with deuterium (^2H or D). This isotopically labeled compound is used extensively in metabolic flux analysis, NMR spectroscopy, and mass spectrometry to study amino acid metabolism, protein turnover, and labeling dynamics in biological systems. L-Proline-d7 is chemically and structurally identical to its non-deuterated counterpart, allowing it to participate in biological pathways without functional disruption. Its high isotopic purity makes it a valuable tracer and internal standard in quantitative biochemical research.
| CAS Number | 39063-89-3 |
| Synonyms | (2S)-2,3,3,4,4,5,5-heptadeuteriopyrrolidine-2-carboxylic acid |
| Molecular Formula | C5H2D7NO2 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2,3,3,4,4,5,5-heptadeuteriopyrrolidine-2-carboxylic acid |
| InChI | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1/i1D2,2D2,3D2,4D |
| InChIKey | ONIBWKKTOPOVIA-BFEYZEMLSA-N |
| SMILES | [2H][C@]1(C(C(C(N1)([2H])[2H])([2H])[2H])([2H])[2H])C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
