For research use only. Not for therapeutic Use.
L-Proline p-nitroanilide (P-pNA) TFA is aproline derivatives.
| Catalog Number | M013677 |
| CAS Number | 108321-19-3 |
| Synonyms | (2S)-N-(4-nitrophenyl)pyrrolidine-2-carboxamide;2,2,2-trifluoroacetic acid |
| Molecular Formula | C13H14F3N3O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C11H13N3O3.C2HF3O2/c15-11(10-2-1-7-12-10)13-8-3-5-9(6-4-8)14(16)17;3-2(4,5)1(6)7/h3-6,10,12H,1-2,7H2,(H,13,15);(H,6,7)/t10-;/m0./s1 |
| InChIKey | KYRVEVYREUUAKH-PPHPATTJSA-N |
| SMILES | C1CC(NC1)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-].C(=O)(C(F)(F)F)O |
| Reference | [1]. Cathal S Mahon, et al. Characterization of a multimeric, eukaryotic prolyl aminopeptidase: an inducible and highly specific intracellular peptidase from the non-pathogenic fungus Talaromyces emersonii. Microbiology (Reading). 2009, 155. |
