For research use only. Not for therapeutic Use.
L-Serine-1-13C(Cat No.:S000607) is a specialized form of serine, an important amino acid involved in protein synthesis, neurotransmitter regulation, and cellular metabolism. The “1-13C” notation signifies that the carbon atom in position 1 of the serine molecule is replaced with the stable carbon isotope carbon-13. This isotopic labeling enables researchers to track the metabolic fate of serine and its involvement in various biochemical pathways with high precision, particularly through techniques like nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry.
CAS Number | 81201-84-5 |
Molecular Formula | C213CH7NO3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-2-amino-3-hydroxy(113C)propanoic acid |
InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1/i3+1 |
InChIKey | MTCFGRXMJLQNBG-NSQKCYGPSA-N |
SMILES | C(C(C(=O)O)N)O |