For research use only. Not for therapeutic Use.
L-Serine-13C(Cat No.:S000638)is a stable isotope-labeled form of the amino acid serine, where one or more of its carbon atoms are replaced with carbon-13 (13C). This labeled serine is extensively used in scientific research, particularly for tracing its metabolic pathways and studying its role in various biological processes using mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. L-Serine-13C helps researchers investigate serine’s involvement in protein synthesis, cell membrane formation, and the production of other amino acids and neurotransmitters.
CAS Number | 89232-77-9 |
Molecular Formula | C213CH7NO3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-2-amino-3-hydroxy(313C)propanoic acid |
InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1/i1+1 |
InChIKey | MTCFGRXMJLQNBG-IJGDANSWSA-N |
SMILES | C(C(C(=O)O)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |