L-Serine-13C3（Cat No.:R024858） is a high-purity isotopically labeled amino acid featuring three carbon-13 atoms, essential for advanced pharmaceutical and biochemical research. This labeled version of L-Serine is crucial for studying protein synthesis, metabolic pathways, and cellular functions. Its stable isotope labeling ensures precise and reliable analytical results, making it ideal for applications in NMR spectroscopy, metabolic flux analysis, and drug development. The enhanced stability and consistency of L-Serine-13C3 make it suitable for various experimental setups, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | R024858 |
| CAS Number | 201595-68-8 |
| Synonyms | L-Serine-1,2,3-13C3 |
| Molecular Formula | C3H7NO3 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | (2S)-2-amino-3-hydroxy(1,2,3-13C3)propanoic acid |
| InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1/i1+1,2+1,3+1 |
| InChIKey | MTCFGRXMJLQNBG-GCCOVPGMSA-N |
| SMILES | [13CH2]([13C@@H]([13C](=O)O)N)O |
