For research use only. Not for therapeutic Use.
L-Serine-15N(Cat No.:S000639)is a stable isotope-labeled version of the amino acid serine, where the nitrogen atom is replaced with nitrogen-15 (15N). This modification is particularly useful for scientific studies that employ techniques like mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy, enabling precise tracking of serine’s metabolic pathways. L-Serine-15N aids in researching serine’s roles in synthesizing proteins, other amino acids, and neurotransmitters such as glycine and D-serine.
Catalog Number | S000639 |
CAS Number | 59935-32-9 |
Molecular Formula | C3H715NO3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-2-(15N)azanyl-3-hydroxypropanoic acid |
InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1/i4+1 |
InChIKey | MTCFGRXMJLQNBG-GZPBOPPUSA-N |
SMILES | C(C(C(=O)O)N)O |