For research use only. Not for therapeutic Use.
L-Serine (Cat.No:R019391) is a non-essential amino acid crucial for protein synthesis and maintaining various physiological functions. It plays a vital role in neurotransmitter synthesis, nucleotide biosynthesis, and cell signaling. L-Serine is essential for brain development and function and has potential therapeutic applications in treating certain neurological disorders and metabolic diseases.
CAS Number | 56-45-1 |
Synonyms | (-)-Serine; (S)-2-Amino-3-hydroxypropanoic Acid; (S)-Serine; (S)-α-Amino-β-hydroxypropionic Acid; 1: PN: US20090069547 PAGE: 10 Claimed Protein; 225: PN: EP2071334 SEQID: 242 Claimed Protein; 225: PN: WO2009077864 SEQID: 242 Claimed Protein; 6: PN: W |
Molecular Formula | C3H7NO3 |
Purity | ≥95% |
Target | Anti-infection |
Storage | -20°C |
IUPAC Name | (2S)-2-amino-3-hydroxypropanoic acid |
InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1 |
InChIKey | MTCFGRXMJLQNBG-REOHCLBHSA-N |
SMILES | C(C(C(=O)O)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |