For research use only. Not for therapeutic Use.
L-Threonine is an essential amino acid vital for protein synthesis and metabolic functions. It plays a crucial role in maintaining proper protein balance, immune function, and digestive health. Widely used in nutritional supplements, pharmaceuticals, and biochemical research, L-Threonine ensures precise and reliable results in studies related to nutrition, metabolism, and therapeutic formulations.
CAS Number | 72-19-5 |
Synonyms | (S)-Threonine; 2-Amino-3-hydroxybutyric Acid; L-(-)-Threonine; NSC 16589; NSC 46701; Threonin; Threonine; [R-(R*,S*)]-2-Amino-3-?hydroxybutanoic Acid; ? |
Molecular Formula | C4H9NO3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | Store at RT |
IUPAC Name | (2S,3R)-2-amino-3-hydroxybutanoic acid |
InChI | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1 |
InChIKey | AYFVYJQAPQTCCC-GBXIJSLDSA-N |
SMILES | CC(C(C(=O)O)N)O |