For research use only. Not for therapeutic Use.
L-Thyronine(Cat No.:M048653)is an endogenous thyroid hormone derivative that plays a role in regulating metabolism and energy balance within the body. It is a metabolite of thyroxine (T4), which is converted into the more active form, triiodothyronine (T3). L-Thyronine is involved in various physiological processes, including the regulation of heart rate, temperature, and energy expenditure. It has been studied for its potential therapeutic applications in treating hypothyroidism and other thyroid-related disorders. In research, L-Thyronine may also be explored for its role in metabolism and potential benefits in enhancing metabolic efficiency.
CAS Number | 1596-67-4 |
Synonyms | (2S)-2-amino-3-[4-(4-hydroxyphenoxy)phenyl]propanoic acid |
Molecular Formula | C15H15NO4 |
Purity | ≥95% |
IUPAC Name | (2S)-2-amino-3-[4-(4-hydroxyphenoxy)phenyl]propanoic acid |
InChI | InChI=1S/C15H15NO4/c16-14(15(18)19)9-10-1-5-12(6-2-10)20-13-7-3-11(17)4-8-13/h1-8,14,17H,9,16H2,(H,18,19)/t14-/m0/s1 |
InChIKey | KKCIOUWDFWQUBT-AWEZNQCLSA-N |
SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)N)OC2=CC=C(C=C2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |