For research use only. Not for therapeutic Use.
L-Tryptophan-13C11（Cat No.:S000642） is a labeled form of the essential amino acid tryptophan, where all eleven of its carbon atoms are replaced with the heavier carbon-13 (13C) isotope. This stable isotopic labeling enhances the detection and analysis capabilities in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy, making it highly valuable in biochemical and pharmacological research. It allows scientists to monitor and study the detailed metabolic pathways of tryptophan, including its role in protein synthesis, serotonin production, and its overall impact on biological processes such as sleep and mood regulation.
| Catalog Number | S000642 |
| CAS Number | 202114-65-6 |
| Molecular Formula | 13C11H12N2O2 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)(1,2,3-13C3)propanoic acid |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1,11+1 |
| InChIKey | QIVBCDIJIAJPQS-WQQZOYGJSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)N |
