For research use only. Not for therapeutic Use.
L-Tryptophan-15N（Cat No.:S000643） is a stable isotope-labeled variant of the essential amino acid tryptophan, where the nitrogen atom is replaced with the heavier isotope nitrogen-15 (15N). This modification is extensively used in scientific research, particularly in protein structure and function studies through techniques like nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry. By incorporating 15N-labeled tryptophan into proteins, researchers can gain detailed insights into protein dynamics, interactions, and folding processes. This isotope labeling is crucial for elucidating biological mechanisms and understanding protein-related diseases.
| Catalog Number | S000643 |
| Molecular Formula | C11H12N15NO2 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-(15N)azanyl-3-(1H-indol-3-yl)propanoic acid |
| InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1/i12+1 |
| InChIKey | QIVBCDIJIAJPQS-ZNXOOWLZSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)N |
