For research use only. Not for therapeutic Use.
L-Tryptophan-d5(Cat No.:S000568) is a specialized form of tryptophan, an essential amino acid crucial for protein synthesis and the precursor to serotonin and melatonin, neurotransmitters involved in mood and sleep regulation. The “d5” designation indicates that five hydrogen atoms in the tryptophan molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling enables precise tracking of tryptophan metabolism and its conversion into serotonin and melatonin using techniques like mass spectrometry.
CAS Number | 62595-11-3 |
Molecular Formula | C11H7D5N2O2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-2-amino-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid |
InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1/i1D,2D,3D,4D,6D |
InChIKey | QIVBCDIJIAJPQS-HLTLGYGQSA-N |
SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)N |