For research use only. Not for therapeutic Use.
L-Tyrosine-1-13C(Cat No.:S000694) is a labeled form of L-tyrosine, where the first carbon atom is enriched with carbon-13, enhancing its detectability for studies utilizing NMR spectroscopy and mass spectrometry. This isotopic labeling is crucial for tracing the metabolic pathways involving tyrosine, an amino acid significant in protein synthesis and the precursor for neurotransmitters such as dopamine, epinephrine, and norepinephrine. The specific enrichment of the alpha carbon allows researchers to monitor and analyze tyrosine’s incorporation into proteins and its transformation within various metabolic processes, providing detailed insights into physiological and biochemical mechanisms.
CAS Number | 81201-89-0 |
Molecular Formula | C813CH11NO3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-2-amino-3-(4-hydroxyphenyl)(113C)propanoic acid |
InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i9+1 |
InChIKey | OUYCCCASQSFEME-DMSOPOIOSA-N |
SMILES | C1=CC(=CC=C1CC(C(=O)O)N)O |