For research use only. Not for therapeutic Use.
L-Tyrosine-13C6(Cat No.:S000695)is a labeled version of L-tyrosine, where all six carbon atoms are enriched with carbon-13, significantly enhancing its detectability in analytical techniques such as NMR spectroscopy and mass spectrometry. This isotopic labeling is invaluable for in-depth studies of protein synthesis and the metabolic pathways involving tyrosine, an amino acid crucial for the production of important neurotransmitters like dopamine and norepinephrine. The complete carbon-13 labeling of L-Tyrosine-13C6 allows researchers to precisely trace and analyze tyrosine’s role and transformations in biological systems, facilitating a better understanding of biochemical processes.
CAS Number | 201595-63-3 |
Molecular Formula | C313C6H11NO3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-2-amino-3-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)propanoic acid |
InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i1+1,2+1,3+1,4+1,6+1,7+1 |
InChIKey | OUYCCCASQSFEME-HXCZJXEJSA-N |
SMILES | C1=CC(=CC=C1CC(C(=O)O)N)O |