For research use only. Not for therapeutic Use.
L-Tyrosine-3,5-13C2(Cat No.:S000696)is a labeled variant of L-tyrosine, where the third and fifth carbon atoms in the aromatic ring are enriched with carbon-13. This specific isotopic labeling enhances its detectability for precise analytical techniques like NMR spectroscopy and mass spectrometry, making it ideal for studying the detailed metabolic pathways involving tyrosine. L-tyrosine is an essential amino acid, crucial for synthesizing neurotransmitters such as dopamine and norepinephrine. The selective carbon-13 labeling at positions 3 and 5 allows researchers to focus on the aromatic ring’s dynamics and interactions within biological systems, providing insights into tyrosine’s metabolic transformations.
CAS Number | 70479-98-0 |
Molecular Formula | C713C2H11NO3 |
Purity | ≥95% |
IUPAC Name | (2S)-2-amino-3-(4-hydroxy(3,5-13C2)cyclohexa-1,3,5-trien-1-yl)propanoic acid |
InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i3+1,4+1 |
InChIKey | OUYCCCASQSFEME-ALJHITAUSA-N |
SMILES | C1=CC(=CC=C1CC(C(=O)O)N)O |