For research use only. Not for therapeutic Use.
L-Tyrosine-d2(Cat No.:S000645) is a deuterium-labeled version of the amino acid tyrosine, where the first carbon atom specifically has two hydrogen atoms replaced with deuterium (D), a heavier isotope of hydrogen. This specific labeling allows for precise tracking and analysis of tyrosine’s metabolic pathways using techniques like mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. By studying this labeled tyrosine, researchers can gain detailed insights into how tyrosine is incorporated into proteins and its role in neurotransmitter synthesis, providing valuable information for understanding biochemical processes and potential therapeutic targets.
CAS Number | 30811-19-9 |
Molecular Formula | C9H9D2NO3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-2-amino-3-(3,5-dideuterio-4-hydroxyphenyl)propanoic acid |
InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i3D,4D |
InChIKey | OUYCCCASQSFEME-ZQCIBQAJSA-N |
SMILES | C1=CC(=CC=C1CC(C(=O)O)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |