L-Valine-13C5(Cat No.:S000657) is a labeled variant of the essential amino acid valine, where five of its carbon atoms are isotopically enriched with carbon-13 (13C). This stable isotopic labeling is useful in various scientific applications, including mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. Researchers use it to trace and analyze metabolic pathways in biochemistry and molecular biology studies. The presence of the 13C isotope allows for precise tracking of valine’s incorporation and metabolism in cells, tissues, or organisms, providing insights into protein synthesis and energy metabolism.
Catalog Number | S000657 |
CAS Number | 55443-52-2 |
Molecular Formula | 13C5H11NO2 |
Purity | 95% |
IUPAC Name | (2S)-2-amino-3-(113C)methyl(1,2,3,4-13C4)butanoic acid |
InChI | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1/i1+1,2+1,3+1,4+1,5+1 |
InChIKey | KZSNJWFQEVHDMF-JRGPAWSWSA-N |
SMILES | CC(C)C(C(=O)O)N |