For research use only. Not for therapeutic Use.
L-Valine-15N（Cat No.:S000697） is a labeled version of L-valine, where the nitrogen atom is enriched with nitrogen-15. This isotopic enhancement increases its detectability in analytical methods like NMR spectroscopy and mass spectrometry, making it highly valuable for studying nitrogen metabolism and protein synthesis. L-Valine is an essential branched-chain amino acid crucial for muscle metabolism, tissue repair, and normal growth. The labeling allows researchers to precisely trace and analyze valine’s incorporation into proteins and its metabolic pathways, offering deeper insights into its biological roles and its impact on metabolic health.
| Catalog Number | S000697 |
| CAS Number | 59935-29-4 |
| Molecular Formula | C5H1115NO2 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| IUPAC Name | (2S)-2-(15N)azanyl-3-methylbutanoic acid |
| InChI | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1/i6+1 |
| InChIKey | KZSNJWFQEVHDMF-JGTYJTGKSA-N |
| SMILES | CC(C)C(C(=O)O)N |
