For research use only. Not for therapeutic Use.
L-Valinol(CAT: R028832) is an amino alcohol derived from L-valine. Its mode of action involves participation in various biochemical processes and interactions due to its structural resemblance to the amino acid valine. Pharmacologically, L-valinol’s actions are linked to its role as a chiral building block in organic synthesis, particularly in the creation of pharmaceutical compounds and other bioactive molecules. Its applications extend to the production of chiral intermediates for drug development, making L-valinol a valuable tool in the synthesis of enantiopure compounds with potential therapeutic applications
Catalog Number | R028832 |
CAS Number | 2026-48-4 |
Synonyms | L-2-Amino-3-methyl-1-butanol; (+)-(S)-Valinol; (+)-2-Amino-3-methyl-1-butanol; (+)-Valinol; (2S)-1-Hydroxy-3-methylbutan-2-amine; (2S)-2-Amino-3-methyl-1-butanol; (2S)-Valinol; (S)-(+)-2-Amino-3-methyl-1-butanol; (S)-(+)-Valinol; (S)-2-Amino-3-methyl |
Molecular Formula | C5H13NO |
Purity | ≥95% |
Storage | Store at +4℃ |
IUPAC Name | (2S)-2-amino-3-methylbutan-1-ol |
InChI | InChI=1S/C5H13NO/c1-4(2)5(6)3-7/h4-5,7H,3,6H2,1-2H3/t5-/m1/s1 |
InChIKey | NWYYWIJOWOLJNR-RXMQYKEDSA-N |
SMILES | CC(C)C(CO)N |