For research use only. Not for therapeutic Use.
L82（Cat No.:I042740）is a peptide designed for research applications, specifically targeting the modulation of cellular processes in various biological systems. Its unique structure and function make it valuable for investigating molecular pathways, protein interactions, and signaling mechanisms. L82 has shown promise in studies related to disease research, including cancer and inflammation. This peptide is useful for developing therapeutic strategies and advancing the understanding of disease mechanisms. Researchers can leverage L82 in experiments to explore potential treatments, optimize drug designs, or investigate biomolecular interactions for innovative therapeutic discoveries.
| CAS Number | 329227-30-7 |
| Synonyms | 5-chloro-4-[(2E)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
| Molecular Formula | C11H8ClN5O4 |
| Purity | ≥95% |
| IUPAC Name | 5-chloro-4-[(2E)-2-[(4-hydroxy-3-nitrophenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
| InChI | InChI=1S/C11H8ClN5O4/c12-10-7(5-14-16-11(10)19)15-13-4-6-1-2-9(18)8(3-6)17(20)21/h1-5,18H,(H2,15,16,19)/b13-4+ |
| InChIKey | WUVOGTSGMTVCGA-YIXHJXPBSA-N |
| SMILES | C1=CC(=C(C=C1/C=N/NC2=C(C(=O)NN=C2)Cl)[N+](=O)[O-])O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
