For research use only. Not for therapeutic Use.
Labuxtinib is c-kit tyrosine kinase inhibitor[1].
| Catalog Number | I040776 |
| CAS Number | 1426449-01-5 |
| Synonyms | N-[5-[5-[(1R,2S)-2-fluorocyclopropyl]-1,2,4-oxadiazol-3-yl]-2-methylphenyl]imidazo[1,2-a]pyridine-3-carboxamide |
| Molecular Formula | C20H16FN5O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H16FN5O2/c1-11-5-6-12(18-24-20(28-25-18)13-9-14(13)21)8-15(11)23-19(27)16-10-22-17-4-2-3-7-26(16)17/h2-8,10,13-14H,9H2,1H3,(H,23,27)/t13-,14-/m0/s1 |
| InChIKey | RHNJOZCVGSBEAG-KBPBESRZSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=NOC(=N2)C3CC3F)NC(=O)C4=CN=C5N4C=CC=C5 |
| Reference | [1]. Yeh Vince, et al. Imidazopyridine compounds and compositions as c-kit kinase inhibitors and their preparation. World Intellectual Property Organization, WO2013033070 A1. 2013-03-07. |
