For research use only. Not for therapeutic Use.
Lacidipine is a dihydropyridine calcium channel blocker used in cardiovascular research, particularly for studying hypertension and related disorders. By selectively inhibiting L-type calcium channels, it relaxes vascular smooth muscles, leading to reduced blood pressure and improved arterial compliance. Lacidipine is notable for its long half-life and high lipophilicity, which ensures sustained antihypertensive effects. Additionally, its antioxidant properties contribute to vascular protection, making it a valuable compound in exploring therapies for cardiovascular diseases and oxidative stress-related conditions.
CAS Number | 103890-78-4 |
Synonyms | GX-1048,GR-43659X,SN-305 |
Molecular Formula | C26H33NO6 |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | >21.3mg/mL in DMSO |
Storage | store -20℃ |
IUPAC Name | diethyl 2,6-dimethyl-4-[2-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]phenyl]-1,4-dihydropyridine-3,5-dicarboxylate |
InChI | 1S/C26H33NO6/c1-8-31-24(29)21-16(3)27-17(4)22(25(30)32-9-2)23(21)19-13-11-10-12-18(19)14-15-20(28)33-26(5,6)7/h10-15,23,27H,8-9H2,1-7H3/b15-14+ |
InChIKey | GKQPCPXONLDCMU-CCEZHUSRSA-N |
SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2/C=C/C(=O)OC(C)(C)C)C(=O)OCC)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |