For research use only. Not for therapeutic Use.
Lactimidomycin(Cat No.:I017464)is a natural macrolide antibiotic derived from Streptomyces species, known for its ability to inhibit protein synthesis by targeting the eukaryotic ribosome. It acts by binding to the ribosomal complex, thereby halting translation and cell growth, making it effective in research focused on eukaryotic protein synthesis and cellular growth regulation. Additionally, Lactimidomycin is valuable in cancer studies due to its ability to selectively impact rapidly dividing cells, contributing insights into potential anticancer mechanisms. Its specificity for eukaryotic cells makes it a significant tool in cellular and molecular biology research.
CAS Number | 134869-15-1 |
Molecular Formula | C₂₆H₃₅NO₆ |
Purity | ≥95% |
Target | Dengue virus |
IUPAC Name | 4-[(Z)-2-hydroxy-5-methyl-7-[(4Z,6Z,10Z)-3-methyl-12-oxo-1-oxacyclododeca-4,6,10-trien-2-yl]-4-oxooct-6-enyl]piperidine-2,6-dione |
InChI | InChI=1S/C26H35NO6/c1-17-10-8-6-4-5-7-9-11-25(32)33-26(17)19(3)12-18(2)22(29)16-21(28)13-20-14-23(30)27-24(31)15-20/h4,6,8-12,17-18,20-21,26,28H,5,7,13-16H2,1-3H3,(H,27,30,31)/b6-4-,10-8-,11-9-,19-12- |
InChIKey | OYOKHBHOTQDIPM-YVQSYIHDSA-N |
SMILES | CC1/C=C\C=C/CC/C=C\C(=O)OC1/C(=C\C(C)C(=O)CC(CC2CC(=O)NC(=O)C2)O)/C |
Reference | [1]. Schneider-Poetsch T, et al. Inhibition of eukaryotic translation elongation by cycloheximide and lactimidomycin. Nat Chem Biol. 2010 Mar;6(3):209-217.<br>[2]. Carocci M, et al. Lactimidomycin is a broad-spectrum inhibitor of dengue and other RNA viruses. Antiviral Res. 2016 Apr;128:57-62. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |