For research use only. Not for therapeutic Use.
Lactoferrin (318-323)(Cat No.:M016057) refers to a specific peptide fragment, consisting of amino acids 318 through 323, derived from lactoferrin, a glycoprotein commonly found in milk and other secretory fluids. Lactoferrin is known for its ability to bind iron, which contributes to its antimicrobial, anti-inflammatory, and immunomodulatory properties. The peptide segment 318-323 plays a role in lactoferrin’s interaction with cellular receptors and pathogens, influencing its biological activities. Studying such specific peptide fragments helps researchers understand the functional domains of lactoferrin and develop targeted therapies for infections, inflammation, and immune system regulation.
Catalog Number | M016057 |
CAS Number | 117667-25-1 |
Synonyms | lactoferrin (318-323) |
Molecular Formula | C32H44N6O10 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | methyl (2S)-2-[[2-[[(2S)-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoyl]amino]acetyl]amino]-3-hydroxypropanoyl]amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoate |
InChI | InChI=1S/C32H44N6O10/c1-18(2)12-24(38-29(44)23(33)13-19-4-8-21(40)9-5-19)30(45)34-16-28(43)37-26(17-39)31(46)35-15-27(42)36-25(32(47)48-3)14-20-6-10-22(41)11-7-20/h4-11,18,23-26,39-41H,12-17,33H2,1-3H3,(H,34,45)(H,35,46)(H,36,42)(H,37,43)(H,38,44)/t23-,24-,25-,26-/m0/s1 |
InChIKey | XKVDFADVPPHGJR-CQJMVLFOSA-N |
SMILES | CC(C)CC(C(=O)NCC(=O)NC(CO)C(=O)NCC(=O)NC(CC1=CC=C(C=C1)O)C(=O)OC)NC(=O)C(CC2=CC=C(C=C2)O)N |