For research use only. Not for therapeutic Use.
Lactulose(CAT: I013820) is a high-purity synthetic disaccharide widely used in pharmaceutical, biochemical, and medical research. Composed of galactose and fructose linked by a β-1,4-glycosidic bond, lactulose is known for its prebiotic and osmotic laxative properties. It plays a crucial role in studying gut health, microbiota modulation, and liver-related conditions such as hepatic encephalopathy. Additionally, Lactulose is employed as a substrate in enzyme studies and in developing treatments for gastrointestinal disorders. With excellent stability and consistent quality, it supports innovation in pharmaceutical development, microbiome research, and clinical applications.
| Catalog Number | I013820 |
| CAS Number | 4618-18-2 |
| Molecular Formula | C₁₂H₂₂O₁₁ |
| Purity | ≥95% |
| Target | Anti-infection |
| Solubility | H2O: ≥ 100 mg/mL |
| IUPAC Name | (3S,4R,5R)-1,3,5,6-tetrahydroxy-4-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexan-2-one |
| InChI | InChI=1S/C12H22O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h5-15,17-21H,1-3H2/t5-,6-,7-,8+,9+,10-,11-,12+/m1/s1 |
| InChIKey | PFCRQPBOOFTZGQ-VZXVHDRGSA-N |
| SMILES | C(C1C(C(C(C(O1)OC(C(CO)O)C(C(=O)CO)O)O)O)O)O |
