Lamivudine-15N2,13C(Cat No.:R006302) is a high-purity isotopically labeled compound essential for advanced pharmaceutical research and antiviral studies. Featuring two nitrogen-15 atoms and one carbon-13 atom, this labeled version of Lamivudine is crucial for investigating the pharmacokinetics, metabolism, and mechanisms of action of nucleoside reverse transcriptase inhibitors (NRTIs). Its precise isotope labeling ensures accurate and reliable analytical results, enhancing the quality of experimental data. Lamivudine-15N2,13C is widely used in research involving HIV treatment, hepatitis B therapy, and drug interaction studies.
Catalog Number | R006302 |
CAS Number | 1217746-03-6 |
Synonyms | 4-Amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2(1H)-pyrimidinone-15N2,13C; (2R-cis)-4-Amino-1-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2(1H)-?pyrimidinone-15N2,13C; (-)-2’-Deoxy-3’-thiacytidine-15N2,13C; (-)-BCH 189-15N2,13C; 3TC-15N2,13C; |
Molecular Formula | C8H11N3O3S |
Purity | 95% |
Storage | Desiccate at +4C |
IUPAC Name | 4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl](213C,1,3-15N2)pyrimidin-2-one |
InChI | InChI=1S/C8H11N3O3S/c9-5-1-2-11(8(13)10-5)6-4-15-7(3-12)14-6/h1-2,6-7,12H,3-4H2,(H2,9,10,13)/t6-,7+/m0/s1/i8+1,10+1,11+1 |
InChIKey | JTEGQNOMFQHVDC-PIAXYVKQSA-N |
SMILES | C1[C@H](O[C@H](S1)CO)[15N]2C=CC(=[15N][13C]2=O)N |