For research use only. Not for therapeutic Use.
Lamivudine（Cat No.:A001138）is an antiviral medication primarily used to treat HIV-1 infection and chronic hepatitis B. As a nucleoside reverse transcriptase inhibitor (NRTI), it works by blocking the reverse transcriptase enzyme, preventing viral replication within the body. Lamivudine is often used in combination with other antiretroviral drugs to enhance treatment efficacy. Known for its good tolerability and safety profile, it significantly reduces viral load and improves immune function. High-purity lamivudine ensures consistent therapeutic outcomes, making it a cornerstone in the management of these chronic viral infections.
| Catalog Number | A001138 |
| CAS Number | 134678-17-4 |
| Synonyms | GR109714X |
| Molecular Formula | C8H11N3O3S |
| Purity | ≥95% |
| Target | Reverse Transcriptase |
| Solubility | >10.5mg/mL in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | 4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| InChI | InChI=1S/C8H11N3O3S/c9-5-1-2-11(8(13)10-5)6-4-15-7(3-12)14-6/h1-2,6-7,12H,3-4H2,(H2,9,10,13)/t6-,7+/m0/s1 |
| InChIKey | JTEGQNOMFQHVDC-NKWVEPMBSA-N |
| SMILES | C1C(OC(S1)CO)N2C=CC(=NC2=O)N |
