For research use only. Not for therapeutic Use.
Lamotrigine-13C3（Cat No.:R003811） is a high-purity isotopically labeled compound vital for advanced pharmaceutical research and drug metabolism studies. This version of Lamotrigine, featuring three carbon-13 atoms, is essential for tracing metabolic pathways, understanding pharmacokinetics, and conducting isotope dilution mass spectrometry. Its stable isotope labeling ensures precise and reliable analytical results, making it suitable for various experimental setups. Ideal for applications in epilepsy and bipolar disorder research, Lamotrigine-13C3 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | R003811 |
| CAS Number | 1188265-38-4 |
| Synonyms | 6-(2,3-Dichlorophenyl)-1,2,4-triazine-3,5-diamine-13C3; 3,5-Diamino-6-(2,3-dichlorophenyl)-1,2,4-triazine-13C3; BW 430C-13C3; LTG-13C3; Lamictal-13C3; Lamictal XR-13C3; Lamotrigin-13C3; |
| Molecular Formula | C9H7Cl2N5 |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | 6-(2,3-dichlorophenyl)-(3,5,6-13C3)1,2,4-triazine-3,5-diamine |
| InChI | InChI=1S/C9H7Cl2N5/c10-5-3-1-2-4(6(5)11)7-8(12)14-9(13)16-15-7/h1-3H,(H4,12,13,14,16)/i7+1,8+1,9+1 |
| InChIKey | PYZRQGJRPPTADH-ULEDQSHZSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)[13C]2=[13C](N=[13C](N=N2)N)N |
