For research use only. Not for therapeutic Use.
Lanperisone（Cat No.:M030056） is a muscle relaxant drug commonly used to treat muscle spasms and associated pain, particularly in conditions like multiple sclerosis, myalgia, and spastic paraplegia. It operates by reducing the rate of firing of the motor neurons and inhibiting the reflex pathways within the central nervous system, thus easing muscle stiffness and improving mobility. Unlike many other muscle relaxants, lanperisone is noted to have fewer sedative side effects, making it more suitable for patients who need to maintain alertness while receiving treatment for muscle-related discomfort.
| Catalog Number | M030056 |
| CAS Number | 116287-14-0 |
| Molecular Formula | C15H18F3NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2R)-2-methyl-3-pyrrolidin-1-yl-1-[4-(trifluoromethyl)phenyl]propan-1-one |
| InChI | InChI=1S/C15H18F3NO/c1-11(10-19-8-2-3-9-19)14(20)12-4-6-13(7-5-12)15(16,17)18/h4-7,11H,2-3,8-10H2,1H3/t11-/m1/s1 |
| InChIKey | RYZCWZZJFAKYHX-LLVKDONJSA-N |
| SMILES | CC(CN1CCCC1)C(=O)C2=CC=C(C=C2)C(F)(F)F |
