For research use only. Not for therapeutic Use.
Lansoprazole is a proton pump inhibitor (PPI) widely used in research and therapy for acid-related disorders such as gastroesophageal reflux disease (GERD), peptic ulcers, and Zollinger-Ellison syndrome. It works by irreversibly inhibiting the H⁺/K⁺-ATPase enzyme in the gastric parietal cells, effectively reducing stomach acid secretion. Lansoprazole also exhibits antioxidant and anti-inflammatory properties, making it valuable in studying gastric mucosal protection. Its high efficacy and favorable pharmacokinetics contribute to its prominence in investigating acid suppression therapies and gastrointestinal health.
CAS Number | 103577-45-3 |
Synonyms | 103577-45-3; Prevacid; Bamalite; Monolitum; Agopton |
Molecular Formula | C16H14F3N3O2S |
Purity | ≥95% |
Target | Anti-infection |
Solubility | >18.5mg/mL in DMSO |
Storage | -20°C |
IUPAC Name | 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methylsulfinyl]-1H-benzimidazole |
InChI | 1S/C16H14F3N3O2S/c1-10-13(20-7-6-14(10)24-9-16(17,18)19)8-25(23)15-21-11-4-2-3-5-12(11)22-15/h2-7H,8-9H2,1H3,(H,21,22) |
InChIKey | MJIHNNLFOKEZEW-UHFFFAOYSA-N |
SMILES | CC1=C(C=CN=C1CS(=O)C2=NC3=CC=CC=C3N2)OCC(F)(F)F |