For research use only. Not for therapeutic Use.
Lansoprazole Sodium（Cat No.:I002735）is a proton pump inhibitor (PPI) used to treat gastrointestinal conditions such as gastroesophageal reflux disease (GERD), peptic ulcers, and Zollinger-Ellison syndrome. It works by inhibiting the H+/K+ ATPase enzyme in the stomach lining, thereby reducing gastric acid production. This reduction in acid helps heal acid-related damage to the stomach and esophagus, relieve symptoms like heartburn, and prevent ulcer formation. Lansoprazole Sodium is favored for its efficacy, rapid action, and prolonged effect, providing significant relief and promoting gastrointestinal health.
| Catalog Number | I002735 |
| CAS Number | 226904-00-3 |
| Synonyms | sodium;2-[[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methylsulfinyl]benzimidazol-1-ide |
| Molecular Formula | C16H13F3N3NaO2S |
| Purity | ≥95% |
| Target | Proton Pump |
| Solubility | DMSO 72 mg/mL; Water <1 mg/mL; Ethanol 14 mg/mL |
| Storage | Store at -20C |
| IUPAC Name | sodium;2-[[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methylsulfinyl]benzimidazol-1-ide |
| InChI | InChI=1S/C16H13F3N3O2S.Na/c1-10-13(20-7-6-14(10)24-9-16(17,18)19)8-25(23)15-21-11-4-2-3-5-12(11)22-15;/h2-7H,8-9H2,1H3;/q-1;+1 |
| InChIKey | OTGPYEHFRKGRIZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CS(=O)C2=NC3=CC=CC=C3[N-]2)OCC(F)(F)F.[Na+] |
