For research use only. Not for therapeutic Use.
Lansoprazole sulfone（Cat No.:R010253）is a metabolite of lansoprazole, a proton pump inhibitor (PPI) commonly used to treat conditions like gastroesophageal reflux disease (GERD), peptic ulcers, and Zollinger-Ellison syndrome. Lansoprazole sulfone forms when lansoprazole is metabolized in the liver. It is typically considered an inactive compound, though its presence in the body can serve as a marker of lansoprazole metabolism. Understanding the levels of lansoprazole sulfone can help researchers study drug metabolism and pharmacokinetics, providing insight into how effectively lansoprazole is processed in individuals and its potential therapeutic outcomes.
| Catalog Number | R010253 |
| CAS Number | 131926-99-3 |
| Synonyms | 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methylsulfonyl]-1H-benzimidazole |
| Molecular Formula | C16H14F3N3O3S |
| Purity | ≥95% |
| IUPAC Name | 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methylsulfonyl]-1H-benzimidazole |
| InChI | InChI=1S/C16H14F3N3O3S/c1-10-13(20-7-6-14(10)25-9-16(17,18)19)8-26(23,24)15-21-11-4-2-3-5-12(11)22-15/h2-7H,8-9H2,1H3,(H,21,22) |
| InChIKey | TVMJMCGRSSSSDJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CS(=O)(=O)C2=NC3=CC=CC=C3N2)OCC(F)(F)F |
