For research use only. Not for therapeutic Use.
Lapatinib, Free Base is a small-molecule tyrosine kinase inhibitor used primarily in the treatment of breast cancer. It selectively targets the human epidermal growth factor receptors (HER2 and EGFR), disrupting signaling pathways that promote tumor growth and proliferation. As a free base form, it offers enhanced solubility and bioavailability, making it suitable for various formulations. Ongoing research explores its efficacy in combination therapies and its potential applications in treating other malignancies, highlighting its significance in cancer therapeutics and personalized medicine.
| Catalog Number | A000334 |
| CAS Number | 231277-92-2 |
| Synonyms | GW-572016, GSK572016 |
| Molecular Formula | C₂₉H₂₆ClFN₄O₄S |
| Purity | ≥95% |
| Target | EGFR |
| Solubility | >29.1mg/mL in DMSO |
| Storage | 3 years -20C powder |
| InChI | InChI=1S/C29H26ClFN4O4S/c1-40(36,37)12-11-32-16-23-7-10-27(39-23)20-5-8-26-24(14-20)29(34-18-33-26)35-22-6-9-28(25(30)15-22)38-17-19-3-2-4-21(31)13-19/h2-10,13-15,18,32H,11-12,16-17H2,1H3,(H,33,34,35) |
| InChIKey | BCFGMOOMADDAQU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CCNCC1=CC=C(O1)C2=CC3=C(C=C2)N=CN=C3NC4=CC(=C(C=C4)OCC5=CC(=CC=C5)F)Cl |
