For research use only. Not for therapeutic Use.
Lappaconitine (LC) is a natural diterpenoid alkaloid (DTA), acting as a human heart sodium channel blocker and possessing a wide range of biological activities, including anti-arrhythmic, anti-inflammatory, antioxidative, anticancer, epileptiform etc.
| Catalog Number | I003167 |
| CAS Number | 32854-75-4 |
| Molecular Formula | C32H44N2O8 |
| Purity | ≥95% |
| Storage | 3 years-20°Cpowder |
| SMILES | CCN1CC2(CCC(C34C2CC(C31)C5(CC(C6CC4C5(C6OC)O)OC)O)OC)OC(=O)C7=CC=CC=C7NC(=O)C |
| Reference | [1] N E Polyakov, et al. Russian Chemical Bulletin. 2007, 56(4): 631-642. |
