For research use only. Not for therapeutic Use.
Lasiodiplodin(CAT: R042565) plays a significant role in the realm of organic chemistry. It is a naturally occurring compound isolated from fungi and has demonstrated various bioactive properties. In organic chemistry, Lasiodiplodin serves as a valuable starting material for the synthesis of structurally complex molecules due to its unique chemical structure.
CAS Number | 32885-81-7 |
Molecular Formula | C17H24O4 |
Purity | ≥95% |
Target | Microorganisms |
Storage | 3 years -20C powder |
IUPAC Name | (9S)-15-hydroxy-13-methoxy-9-methyl-10-oxabicyclo[10.4.0]hexadeca-1(12),13,15-trien-11-one |
InChI | InChI=1S/C17H24O4/c1-12-8-6-4-3-5-7-9-13-10-14(18)11-15(20-2)16(13)17(19)21-12/h10-12,18H,3-9H2,1-2H3/t12-/m0/s1 |
InChIKey | OKWRDLQBKAOJNC-LBPRGKRZSA-N |
SMILES | CC1CCCCCCCC2=CC(=CC(=C2C(=O)O1)OC)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |