For research use only. Not for therapeutic Use.
Lasofoxifene-d4 Sulfate is a deuterated form of lasofoxifene sulfate, a selective estrogen receptor modulator (SERM). It binds to estrogen receptors, exerting both estrogenic and anti-estrogenic effects depending on the target tissue. This compound is primarily used in pharmaceutical research for studying osteoporosis and breast cancer treatments, due to its role in regulating bone density and inhibiting tumor growth. The deuterium labeling enhances metabolic stability and allows for precise pharmacokinetic and pharmacodynamic studies. In organic chemistry, it aids in understanding drug interactions, while in material science, it is used for developing advanced analytical techniques.
CAS Number | 1246817-62-8 |
Synonyms | (5R,6S)-5,6,7,8-Tetrahydro-6-phenyl-5-[4-[2-(1-pyrrolidinyl)ethoxy-d4]phenyl]-2-naphthalenol 2-(Hydrogen Sulfate); |
Molecular Formula | C28H31NO5S |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | [(5R,6S)-6-phenyl-5-[4-(1,1,2,2-tetradeuterio-2-pyrrolidin-1-ylethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-yl] hydrogen sulfate |
InChI | InChI=1S/C28H31NO5S/c30-35(31,32)34-25-13-15-27-23(20-25)10-14-26(21-6-2-1-3-7-21)28(27)22-8-11-24(12-9-22)33-19-18-29-16-4-5-17-29/h1-3,6-9,11-13,15,20,26,28H,4-5,10,14,16-19H2,(H,30,31,32)/t26-,28+/m1/s1/i18D2,19D2 |
InChIKey | NXQINUGCNDMKEW-NXOFZFLXSA-N |
SMILES | [2H]C([2H])(C([2H])([2H])OC1=CC=C(C=C1)[C@H]2[C@H](CCC3=C2C=CC(=C3)OS(=O)(=O)O)C4=CC=CC=C4)N5CCCC5 |