For research use only. Not for therapeutic Use.
Lauric Acid-d23(Cat No.:R016598) is a high-purity, deuterium-labeled compound essential for advanced biochemical and pharmaceutical research. Featuring twenty-three deuterium atoms, this isotopically labeled version of Lauric Acid is crucial for studies on lipid metabolism, fatty acid pathways, and biochemical processes. Lauric Acid-d23 aids in the development of therapeutic agents and enhances the understanding of metabolic functions and lipid-related mechanisms, making it a valuable tool for scientific investigations and drug development.
Catalog Number | R016598 |
CAS Number | 59154-43-7 |
Synonyms | Dodecanoic Acid-d23;1-Dodecanoic Acid-d23; 1-Undecanecarboxylic Acid-d23; ABL-d23; Aliphat No. 4-d23; ContraZeck-d23; Dodecylic Acid-d23; Edenor C 12-d23; Edenor C 1298-100-d23; Emery 651-d23; Hystrene 9512-d23; Imex C 1299-d23; Kortacid 1299-d23; La |
Molecular Formula | C12H24O2 |
Purity | ≥95% |
Target | Anti-infection |
Storage | Room temperature |
IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosadeuteriododecanoic acid |
InChI | InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)/i1D3,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2 |
InChIKey | POULHZVOKOAJMA-SJTGVFOPSA-N |
SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O |