For research use only. Not for therapeutic Use.
Lazabemide(CAT: I000228) is a selective and reversible inhibitor of monoamine oxidase B (MAO-B), an enzyme responsible for the breakdown of dopamine and other monoamines. By inhibiting MAO-B, lazabemide increases dopamine availability, making it particularly valuable in neuroscience research. It has been studied for its potential therapeutic effects in Parkinson’s disease and Alzheimer’s disease, where dopamine and monoamine regulation are crucial. Lazabemide serves as a critical tool for exploring the role of MAO-B in neurodegenerative disorders and advancing the development of treatments targeting dopamine-related dysfunctions.
| Catalog Number | I000228 |
| CAS Number | 103878-84-8 |
| Synonyms | Ro 19-6327/000 |
| Molecular Formula | C8H10ClN3O |
| Purity | ≥95% |
| Target | Monoamine Oxidase |
| Solubility | DMSO: ≥ 34 mg/mL |
| Storage | -20°C |
| IC50 | 30 nM [1] |
| IUPAC Name | N-(2-aminoethyl)-5-chloropyridine-2-carboxamide |
| InChI | InChI=1S/C8H10ClN3O/c9-6-1-2-7(12-5-6)8(13)11-4-3-10/h1-2,5H,3-4,10H2,(H,11,13) |
| InChIKey | JZXRLKWWVNUZRB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)C(=O)NCCN |
