For research use only. Not for therapeutic Use.
Lck inhibitor 2 (Cat No.:I005622) is a multi-target tyrosine kinase inhibitor that includes Lck, Btk, Lyn, Btk and Txk with IC50s of 13nM, 9nM, 3nM, 26nM and 2nM, respectively.
| Catalog Number | I005622 |
| CAS Number | 944795-06-6 |
| Synonyms | 3-[[4-(5-hydroxy-2-methylanilino)pyrimidin-2-yl]amino]benzamide |
| Molecular Formula | C18H17N5O2 |
| Purity | ≥95% |
| Target | Src |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IC50 | 13 nM(Lck) |
| IUPAC Name | 3-[[4-(5-hydroxy-2-methylanilino)pyrimidin-2-yl]amino]benzamide |
| InChI | InChI=1S/C18H17N5O2/c1-11-5-6-14(24)10-15(11)22-16-7-8-20-18(23-16)21-13-4-2-3-12(9-13)17(19)25/h2-10,24H,1H3,(H2,19,25)(H2,20,21,22,23) |
| InChIKey | SFCBIFOAGRZJNX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)O)NC2=NC(=NC=C2)NC3=CC=CC(=C3)C(=O)N |
