For research use only. Not for therapeutic Use.
Lck Inhibitor 2(Cat No.:I005622)is a small molecule that selectively targets and inhibits the protein tyrosine kinase Lck (lymphocyte-specific protein tyrosine kinase). Lck plays a crucial role in T-cell receptor (TCR) signaling and the activation of immune responses. By inhibiting Lck, Lck Inhibitor 2 can modulate T-cell activation and function, making it a potential tool for immune-related research and therapy. It has been studied in the context of autoimmune diseases, cancer immunotherapy, and transplant rejection. Further studies are needed to evaluate its therapeutic potential, safety, and efficacy in clinical applications.
CAS Number | 944795-06-6 |
Synonyms | 3-[[4-(5-hydroxy-2-methylanilino)pyrimidin-2-yl]amino]benzamide |
Molecular Formula | C18H17N5O2 |
Purity | ≥95% |
Target | Src |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IC50 | 13 nM(Lck) |
IUPAC Name | 3-[[4-(5-hydroxy-2-methylanilino)pyrimidin-2-yl]amino]benzamide |
InChI | InChI=1S/C18H17N5O2/c1-11-5-6-14(24)10-15(11)22-16-7-8-20-18(23-16)21-13-4-2-3-12(9-13)17(19)25/h2-10,24H,1H3,(H2,19,25)(H2,20,21,22,23) |
InChIKey | SFCBIFOAGRZJNX-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1)O)NC2=NC(=NC=C2)NC3=CC=CC(=C3)C(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |